C19H23FN4O — CID 110116957
[4-[3-[(dimethylamino)methyl]pyrazin-2-yl]piperidin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 110116957) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is [4-[3-[(dimethylamino)methyl]pyrazin-2-yl]piperidin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[3-[(dimethylamino)methyl]pyrazin-2-yl]piperidin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110116957 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [4-[3-[(dimethylamino)methyl]pyrazin-2-yl]piperidin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CN(C)Cc1nccnc1C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H23FN4O/c1-23(2)13-17-18(22-10-9-21-17)14-7-11-24(12-8-14)19(25)15-3-5-16(20)6-4-15/h3-6,9-10,14H,7-8,11-13H2,1-2H3 |
| InChIKey | SOTRJABUINQVQK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |