C19H25N3O2S — CID 110117887
N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 110117887) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 110117887 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCc2cnc(C3(C)CCCCO3)nc2)cs1 |
| InChI | InChI=1S/C19H25N3O2S/c1-13(2)16-8-15(12-25-16)17(23)20-9-14-10-21-18(22-11-14)19(3)6-4-5-7-24-19/h8,10-13H,4-7,9H2,1-3H3,(H,20,23) |
| InChIKey | VPSFDVUPKLIKEQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |