C20H25N3O3 — CID 110117891
N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-3-phenoxypropanamide (PubChem CID 110117891) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-3-phenoxypropanamide.
| Compound Name | N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 110117891 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[[2-(2-methyloxan-2-yl)pyrimidin-5-yl]methyl]-3-phenoxypropanamide |
| SMILES | CC1(c2ncc(CNC(=O)CCOc3ccccc3)cn2)CCCCO1 |
| InChI | InChI=1S/C20H25N3O3/c1-20(10-5-6-11-26-20)19-22-14-16(15-23-19)13-21-18(24)9-12-25-17-7-3-2-4-8-17/h2-4,7-8,14-15H,5-6,9-13H2,1H3,(H,21,24) |
| InChIKey | RLOPVHZGGJKLSJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |