C12H16N4O3S — CID 110118136
7-(1-methylsulfonylpiperidin-2-yl)-8H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 110118136) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 7-(1-methylsulfonylpiperidin-2-yl)-8H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 7-(1-methylsulfonylpiperidin-2-yl)-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 110118136 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 7-(1-methylsulfonylpiperidin-2-yl)-8H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | CS(=O)(=O)N1CCCCC1c1cc(=O)n2ccnc2[nH]1 |
| InChI | InChI=1S/C12H16N4O3S/c1-20(18,19)16-6-3-2-4-10(16)9-8-11(17)15-7-5-13-12(15)14-9/h5,7-8,10H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | ULMVUIYPTWCIMP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |