C15H22N4O2 — CID 125017304
7-[(2S)-1-(2-ethoxyethyl)piperidin-2-yl]-8H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 125017304) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 7-[(2S)-1-(2-ethoxyethyl)piperidin-2-yl]-8H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 7-[(2S)-1-(2-ethoxyethyl)piperidin-2-yl]-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 125017304 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 7-[(2S)-1-(2-ethoxyethyl)piperidin-2-yl]-8H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCOCCN1CCCC[C@H]1c1cc(=O)n2ccnc2[nH]1 |
| InChI | InChI=1S/C15H22N4O2/c1-2-21-10-9-18-7-4-3-5-13(18)12-11-14(20)19-8-6-16-15(19)17-12/h6,8,11,13H,2-5,7,9-10H2,1H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | NTHLSPHBPXBOQQ-ZDUSSCGKSA-N |
| XLogP | 1.59 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|