C18H20O2S — CID 11012030
(1R,5R,8S)-6-ethoxy-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene (PubChem CID 11012030) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is (1R,5R,8S)-6-ethoxy-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene.
| Compound Name | (1R,5R,8S)-6-ethoxy-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene |
|---|---|
| PubChem CID | 11012030 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1R,5R,8S)-6-ethoxy-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene |
| SMILES | CCOC1=C(Sc2ccccc2)[C@@H]2C=C[C@@]3(CCC[C@@H]13)O2 |
| InChI | InChI=1S/C18H20O2S/c1-2-19-16-14-9-6-11-18(14)12-10-15(20-18)17(16)21-13-7-4-3-5-8-13/h3-5,7-8,10,12,14-15H,2,6,9,11H2,1H3/t14-,15-,18+/m0/s1 |
| InChIKey | IZAYXGBWCWBMEF-RLFYNMQTSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|