C19H22O3S — CID 11759315
(1R,5S,8S)-6-methoxy-5-(methoxymethyl)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene (PubChem CID 11759315) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is (1R,5S,8S)-6-methoxy-5-(methoxymethyl)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene.
| Compound Name | (1R,5S,8S)-6-methoxy-5-(methoxymethyl)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene |
|---|---|
| PubChem CID | 11759315 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (1R,5S,8S)-6-methoxy-5-(methoxymethyl)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene |
| SMILES | COC[C@@]12CCC[C@@]13C=C[C@H](O3)C(Sc1ccccc1)=C2OC |
| InChI | InChI=1S/C19H22O3S/c1-20-13-18-10-6-11-19(18)12-9-15(22-19)16(17(18)21-2)23-14-7-4-3-5-8-14/h3-5,7-9,12,15H,6,10-11,13H2,1-2H3/t15-,18+,19+/m0/s1 |
| InChIKey | OFGNJSAQQIPECV-KFKAGJAMSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|