C19H24OS — CID 10447555
(3aS,6aS)-3a,6a-dimethyl-6-phenylsulfanyl-5-prop-2-enoxy-1,2,3,4-tetrahydropentalene (PubChem CID 10447555) has the molecular formula C19H24OS and a molecular weight of 300.47 g/mol. Its IUPAC name is (3aS,6aS)-3a,6a-dimethyl-6-phenylsulfanyl-5-prop-2-enoxy-1,2,3,4-tetrahydropentalene.
| Compound Name | (3aS,6aS)-3a,6a-dimethyl-6-phenylsulfanyl-5-prop-2-enoxy-1,2,3,4-tetrahydropentalene |
|---|---|
| PubChem CID | 10447555 |
| Molecular Formula | C19H24OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3aS,6aS)-3a,6a-dimethyl-6-phenylsulfanyl-5-prop-2-enoxy-1,2,3,4-tetrahydropentalene |
| SMILES | C=CCOC1=C(Sc2ccccc2)[C@@]2(C)CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C19H24OS/c1-4-13-20-16-14-18(2)11-8-12-19(18,3)17(16)21-15-9-6-5-7-10-15/h4-7,9-10H,1,8,11-14H2,2-3H3/t18-,19+/m0/s1 |
| InChIKey | FKYTWZNQROEXFY-RBUKOAKNSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|