C20H24FN3O2 — CID 110120546
4-fluoro-2-[6-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrazin-2-yl]benzoic acid (PubChem CID 110120546) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-fluoro-2-[6-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 4-fluoro-2-[6-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110120546 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-fluoro-2-[6-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrazin-2-yl]benzoic acid |
| SMILES | CC(C)N1CCC(Cc2cncc(-c3cc(F)ccc3C(=O)O)n2)CC1 |
| InChI | InChI=1S/C20H24FN3O2/c1-13(2)24-7-5-14(6-8-24)9-16-11-22-12-19(23-16)18-10-15(21)3-4-17(18)20(25)26/h3-4,10-14H,5-9H2,1-2H3,(H,25,26) |
| InChIKey | FLDOHRJKGQQGKR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |