C19H20FN3O3 — CID 125020327
2-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyrazin-2-yl]-4-fluorobenzoic acid (PubChem CID 125020327) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyrazin-2-yl]-4-fluorobenzoic acid.
| Compound Name | 2-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyrazin-2-yl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 125020327 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[6-[[(3S)-1-acetylpiperidin-3-yl]methyl]pyrazin-2-yl]-4-fluorobenzoic acid |
| SMILES | CC(=O)N1CCC[C@@H](Cc2cncc(-c3cc(F)ccc3C(=O)O)n2)C1 |
| InChI | InChI=1S/C19H20FN3O3/c1-12(24)23-6-2-3-13(11-23)7-15-9-21-10-18(22-15)17-8-14(20)4-5-16(17)19(25)26/h4-5,8-10,13H,2-3,6-7,11H2,1H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | YBXVBAGLUXKORU-ZDUSSCGKSA-N |
| XLogP | 2.78 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |