C25H32ClN5O3 — CID 110122298
3-[4-[2-(3-chloro-4-morpholin-4-ylanilino)-2-oxoethyl]-1-methylpiperazin-2-yl]-N-methylbenzamide (PubChem CID 110122298) has the molecular formula C25H32ClN5O3 and a molecular weight of 486.02 g/mol. Its IUPAC name is 3-[4-[2-(3-chloro-4-morpholin-4-ylanilino)-2-oxoethyl]-1-methylpiperazin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[4-[2-(3-chloro-4-morpholin-4-ylanilino)-2-oxoethyl]-1-methylpiperazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110122298 |
| Molecular Formula | C25H32ClN5O3 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 3-[4-[2-(3-chloro-4-morpholin-4-ylanilino)-2-oxoethyl]-1-methylpiperazin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C2CN(CC(=O)Nc3ccc(N4CCOCC4)c(Cl)c3)CCN2C)c1 |
| InChI | InChI=1S/C25H32ClN5O3/c1-27-25(33)19-5-3-4-18(14-19)23-16-30(9-8-29(23)2)17-24(32)28-20-6-7-22(21(26)15-20)31-10-12-34-13-11-31/h3-7,14-15,23H,8-13,16-17H2,1-2H3,(H,27,33)(H,28,32) |
| InChIKey | AECLBOQGZJDRDR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|