C23H27N5O4 — CID 110122795
N-[3-[[4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methylamino]-3-oxopropyl]pyridine-3-carboxamide (PubChem CID 110122795) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[3-[[4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methylamino]-3-oxopropyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methylamino]-3-oxopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110122795 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[3-[[4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methylamino]-3-oxopropyl]pyridine-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1cccnc1)NCc1ccc([C@@H]2NC(=O)N[C@H]3OCCC[C@H]32)cc1 |
| InChI | InChI=1S/C23H27N5O4/c29-19(9-11-25-21(30)17-3-1-10-24-14-17)26-13-15-5-7-16(8-6-15)20-18-4-2-12-32-22(18)28-23(31)27-20/h1,3,5-8,10,14,18,20,22H,2,4,9,11-13H2,(H,25,30)(H,26,29)(H2,27,28,31)/t18-,20-,22-/m0/s1 |
| InChIKey | NMMLNTZVTRPLKM-VCOUNFBDSA-N |
| XLogP | 1.62 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |