C17H27N5O3 — CID 110123347
1-[4-[[4-hydroxy-1-(1H-imidazole-2-carbonyl)azepan-4-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 110123347) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[4-[[4-hydroxy-1-(1H-imidazole-2-carbonyl)azepan-4-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-hydroxy-1-(1H-imidazole-2-carbonyl)azepan-4-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110123347 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-[4-[[4-hydroxy-1-(1H-imidazole-2-carbonyl)azepan-4-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2(O)CCCN(C(=O)c3ncc[nH]3)CC2)CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-14(23)21-11-9-20(10-12-21)13-17(25)3-2-7-22(8-4-17)16(24)15-18-5-6-19-15/h5-6,25H,2-4,7-13H2,1H3,(H,18,19) |
| InChIKey | CDSQFOATSFZEOR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |