C21H28O2 — CID 11012423
7-methoxy-1,1,4a-trimethyl-6-propan-2-yl-3,9-dihydro-2H-phenanthren-4-one (PubChem CID 11012423) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 7-methoxy-1,1,4a-trimethyl-6-propan-2-yl-3,9-dihydro-2H-phenanthren-4-one.
| Compound Name | 7-methoxy-1,1,4a-trimethyl-6-propan-2-yl-3,9-dihydro-2H-phenanthren-4-one |
|---|---|
| PubChem CID | 11012423 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 7-methoxy-1,1,4a-trimethyl-6-propan-2-yl-3,9-dihydro-2H-phenanthren-4-one |
| SMILES | COc1cc2c(cc1C(C)C)C1(C)C(=O)CCC(C)(C)C1=CC2 |
| InChI | InChI=1S/C21H28O2/c1-13(2)15-12-16-14(11-17(15)23-6)7-8-18-20(3,4)10-9-19(22)21(16,18)5/h8,11-13H,7,9-10H2,1-6H3 |
| InChIKey | SESJPWFVIUJFIF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|