C20H26O — CID 15275960
(4aR)-1,1,4a-trimethyl-7-propan-2-yl-4,9-dihydro-3H-phenanthren-2-one (PubChem CID 15275960) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (4aR)-1,1,4a-trimethyl-7-propan-2-yl-4,9-dihydro-3H-phenanthren-2-one.
| Compound Name | (4aR)-1,1,4a-trimethyl-7-propan-2-yl-4,9-dihydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 15275960 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (4aR)-1,1,4a-trimethyl-7-propan-2-yl-4,9-dihydro-3H-phenanthren-2-one |
| SMILES | CC(C)c1ccc2c(c1)CC=C1C(C)(C)C(=O)CC[C@@]12C |
| InChI | InChI=1S/C20H26O/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(3,4)18(21)10-11-20(16,17)5/h6,8-9,12-13H,7,10-11H2,1-5H3/t20-/m1/s1 |
| InChIKey | TYRUXAFKNYIZRG-HXUWFJFHSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|