About (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one
(3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one (PubChem CID 167207593) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one |
| PubChem CID | 167207593 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one |
| SMILES | CC(C)c1ccc2c(c1)CC[C@@]21CCC(=O)N1 |
| InChI | InChI=1S/C15H19NO/c1-10(2)11-3-4-13-12(9-11)5-7-15(13)8-6-14(17)16-15/h3-4,9-10H,5-8H2,1-2H3,(H,16,17)/t15-/m1/s1 |
| InChIKey | RTHSYPOZIRKJFD-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one?
The IUPAC name of (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one (CID 167207593) is (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one.
What is the SMILES notation for (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one?
The canonical SMILES for (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one is CC(C)c1ccc2c(c1)CC[C@@]21CCC(=O)N1.
What is the InChIKey of (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one?
The InChIKey is RTHSYPOZIRKJFD-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H19NO/c1-10(2)11-3-4-13-12(9-11)5-7-15(13)8-6-14(17)16-15/h3-4,9-10H,5-8H2,1-2H3,(H,16,17)/t15-/m1/s1.
What are the key properties of (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one?
(3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one has a molecular weight of 229.32 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-propan-2-ylspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-one is sourced from PubChem (CID 167207593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).