C12H15F2N — CID 138535856
1,1-difluoro-6-propan-2-yl-3,4-dihydro-2H-isoquinoline (PubChem CID 138535856) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is 1,1-difluoro-6-propan-2-yl-3,4-dihydro-2H-isoquinoline.
| Compound Name | 1,1-difluoro-6-propan-2-yl-3,4-dihydro-2H-isoquinoline |
|---|---|
| PubChem CID | 138535856 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1,1-difluoro-6-propan-2-yl-3,4-dihydro-2H-isoquinoline |
| SMILES | CC(C)c1ccc2c(c1)CCNC2(F)F |
| InChI | InChI=1S/C12H15F2N/c1-8(2)9-3-4-11-10(7-9)5-6-15-12(11,13)14/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | LTLNCDDVLYGTBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|