C24H28F2N2S — CID 138536285
5-[2-(1,1-difluoro-3,4-dihydro-2H-isoquinolin-6-yl)propyl]-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-7-thiol (PubChem CID 138536285) has the molecular formula C24H28F2N2S and a molecular weight of 414.57 g/mol. Its IUPAC name is 5-[2-(1,1-difluoro-3,4-dihydro-2H-isoquinolin-6-yl)propyl]-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-7-thiol.
| Compound Name | 5-[2-(1,1-difluoro-3,4-dihydro-2H-isoquinolin-6-yl)propyl]-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-7-thiol |
|---|---|
| PubChem CID | 138536285 |
| Molecular Formula | C24H28F2N2S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 5-[2-(1,1-difluoro-3,4-dihydro-2H-isoquinolin-6-yl)propyl]-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-7-thiol |
| SMILES | C=CCN1CCc2c(CC(C)c3ccc4c(c3)CCNC4(F)F)cc(S)cc2C1 |
| InChI | InChI=1S/C24H28F2N2S/c1-3-9-28-10-7-22-19(13-21(29)14-20(22)15-28)11-16(2)17-4-5-23-18(12-17)6-8-27-24(23,25)26/h3-5,12-14,16,27,29H,1,6-11,15H2,2H3 |
| InChIKey | GAVRGXZLCGSCHK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|