C15H20ClNO3 — CID 110125598
3-chloro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-N-methylbenzamide (PubChem CID 110125598) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110125598 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-chloro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]-N-methylbenzamide |
| SMILES | CO[C@@H]1CCC[C@@H](N(C)C(=O)c2cccc(Cl)c2)[C@H]1O |
| InChI | InChI=1S/C15H20ClNO3/c1-17(12-7-4-8-13(20-2)14(12)18)15(19)10-5-3-6-11(16)9-10/h3,5-6,9,12-14,18H,4,7-8H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | SLPYGJWTGFJPMQ-MGPQQGTHSA-N |
| XLogP | 2.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |