C14H18ClNO3 — CID 110143758
3-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methylbenzamide (PubChem CID 110143758) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 3-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110143758 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-chloro-N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(Cl)c1)[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H18ClNO3/c1-16(11-6-3-7-12(17)13(11)18)14(19)9-4-2-5-10(15)8-9/h2,4-5,8,11-13,17-18H,3,6-7H2,1H3/t11-,12-,13-/m1/s1 |
| InChIKey | RLLQHAGCEIDMMO-JHJVBQTASA-N |
| XLogP | 1.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |