C22H22O2 — CID 11012594
(1R,2S,7R,8S,11R,12S,17R,18S)-heptacyclo[16.2.1.18,11.02,17.03,15.06,14.07,12]docosa-3(15),4,6(14)-triene-13,16-dione (PubChem CID 11012594) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (1R,2S,7R,8S,11R,12S,17R,18S)-heptacyclo[16.2.1.18,11.02,17.03,15.06,14.07,12]docosa-3(15),4,6(14)-triene-13,16-dione.
| Compound Name | (1R,2S,7R,8S,11R,12S,17R,18S)-heptacyclo[16.2.1.18,11.02,17.03,15.06,14.07,12]docosa-3(15),4,6(14)-triene-13,16-dione |
|---|---|
| PubChem CID | 11012594 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (1R,2S,7R,8S,11R,12S,17R,18S)-heptacyclo[16.2.1.18,11.02,17.03,15.06,14.07,12]docosa-3(15),4,6(14)-triene-13,16-dione |
| SMILES | O=C1c2c(ccc3c2C(=O)[C@H]2[C@@H]4CC[C@@H](C4)[C@@H]32)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C22H22O2/c23-21-17-11-3-1-9(7-11)15(17)13-5-6-14-16-10-2-4-12(8-10)18(16)22(24)20(14)19(13)21/h5-6,9-12,15-18H,1-4,7-8H2/t9-,10+,11+,12-,15-,16+,17-,18+ |
| InChIKey | ISKIQUZFXMKBAG-JIMKBPLRSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |