C16H25N3O2 — CID 110126599
1-[(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(1,5-dimethylpyrazol-4-yl)propan-1-one (PubChem CID 110126599) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(1,5-dimethylpyrazol-4-yl)propan-1-one.
| Compound Name | 1-[(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(1,5-dimethylpyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 110126599 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-[(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3-(1,5-dimethylpyrazol-4-yl)propan-1-one |
| SMILES | COC1C[C@@H]2CN(C(=O)CCc3cnn(C)c3C)C[C@@H]2C1 |
| InChI | InChI=1S/C16H25N3O2/c1-11-12(8-17-18(11)2)4-5-16(20)19-9-13-6-15(21-3)7-14(13)10-19/h8,13-15H,4-7,9-10H2,1-3H3/t13-,14+,15? |
| InChIKey | QYQOACZYSOLAAA-YIONKMFJSA-N |
| XLogP | 1.54 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |