methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate

C11H18N2O2 — CID 146474722

IUPACmethyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate
SMILESCOC(=O)C(C)CCc1cnn(C)c1C
InChIInChI=1S/C11H18N2O2/c1-8(11(14)15-4)5-6-10-7-12-13(3)9(10)2/h7-8H,5-6H2,1-4H3
InChIKeyYKCBDJBXHDMZHQ-UHFFFAOYSA-N
MW210.28 g/mol
LogP1.47
Rot. Bonds4

About methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate

methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate (PubChem CID 146474722) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate.

Molecular Properties

Compound Namemethyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate
PubChem CID146474722
Molecular FormulaC11H18N2O2
Molecular Weight210.28 g/mol
Exact Mass210.14
IUPAC Namemethyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate
SMILESCOC(=O)C(C)CCc1cnn(C)c1C
InChIInChI=1S/C11H18N2O2/c1-8(11(14)15-4)5-6-10-7-12-13(3)9(10)2/h7-8H,5-6H2,1-4H3
InChIKeyYKCBDJBXHDMZHQ-UHFFFAOYSA-N
XLogP1.47
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 51.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate?
The IUPAC name of methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate (CID 146474722) is methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate.
What is the SMILES notation for methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate?
The canonical SMILES for methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate is COC(=O)C(C)CCc1cnn(C)c1C.
What is the InChIKey of methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate?
The InChIKey is YKCBDJBXHDMZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-8(11(14)15-4)5-6-10-7-12-13(3)9(10)2/h7-8H,5-6H2,1-4H3.
What are the key properties of methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate?
methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate has a molecular weight of 210.28 g/mol, XLogP of 1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,5-dimethylpyrazol-4-yl)-2-methylbutanoate is sourced from PubChem (CID 146474722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).