C12H16N2O3 — CID 110126612
[(3aS,6aR)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-5-yl)methanone (PubChem CID 110126612) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(3aS,6aR)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-5-yl)methanone.
| Compound Name | [(3aS,6aR)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 110126612 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [(3aS,6aR)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-5-yl)methanone |
| SMILES | COC1C[C@@H]2CN(C(=O)c3cnco3)C[C@@H]2C1 |
| InChI | InChI=1S/C12H16N2O3/c1-16-10-2-8-5-14(6-9(8)3-10)12(15)11-4-13-7-17-11/h4,7-10H,2-3,5-6H2,1H3/t8-,9+,10? |
| InChIKey | LYLRURLJKXBKFO-ULKQDVFKSA-N |
| XLogP | 1.17 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |