C9H13N3O2 — CID 83617619
1,4-diazepan-1-yl(1,3-oxazol-5-yl)methanone (PubChem CID 83617619) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1,4-diazepan-1-yl(1,3-oxazol-5-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 83617619 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1,4-diazepan-1-yl(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1CCCNCC1 |
| InChI | InChI=1S/C9H13N3O2/c13-9(8-6-11-7-14-8)12-4-1-2-10-3-5-12/h6-7,10H,1-5H2 |
| InChIKey | VTNXWZGVBQHFHX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |