C10H16N4O — CID 83883938
1,4-diazepan-1-yl-(3-methylimidazol-4-yl)methanone (PubChem CID 83883938) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(3-methylimidazol-4-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(3-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 83883938 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1,4-diazepan-1-yl-(3-methylimidazol-4-yl)methanone |
| SMILES | Cn1cncc1C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H16N4O/c1-13-8-12-7-9(13)10(15)14-5-2-3-11-4-6-14/h7-8,11H,2-6H2,1H3 |
| InChIKey | KZHWIDGRUPWMAD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |