C12H19N5O — CID 103511608
(3-methylimidazol-4-yl)-(3-piperazin-1-ylazetidin-1-yl)methanone (PubChem CID 103511608) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is (3-methylimidazol-4-yl)-(3-piperazin-1-ylazetidin-1-yl)methanone.
| Compound Name | (3-methylimidazol-4-yl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 103511608 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (3-methylimidazol-4-yl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
| SMILES | Cn1cncc1C(=O)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C12H19N5O/c1-15-9-14-6-11(15)12(18)17-7-10(8-17)16-4-2-13-3-5-16/h6,9-10,13H,2-5,7-8H2,1H3 |
| InChIKey | QKFILZWXLHVFAV-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |