C9H10N4O3 — CID 103511484
4-(3-methylimidazole-4-carbonyl)piperazine-2,6-dione (PubChem CID 103511484) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-(3-methylimidazole-4-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(3-methylimidazole-4-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 103511484 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 4-(3-methylimidazole-4-carbonyl)piperazine-2,6-dione |
| SMILES | Cn1cncc1C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C9H10N4O3/c1-12-5-10-2-6(12)9(16)13-3-7(14)11-8(15)4-13/h2,5H,3-4H2,1H3,(H,11,14,15) |
| InChIKey | RHDRGHCKYKQLBC-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|