About N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide
N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide (PubChem CID 110126858) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide |
| PubChem CID | 110126858 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCN(Cc2ncc[nH]2)CC[C@@H]1O |
| InChI | InChI=1S/C12H20N4O2/c1-9(17)15-10-2-6-16(7-3-11(10)18)8-12-13-4-5-14-12/h4-5,10-11,18H,2-3,6-8H2,1H3,(H,13,14)(H,15,17)/t10-,11-/m0/s1 |
| InChIKey | BRWZCLTZGFFPQT-QWRGUYRKSA-N |
| XLogP | -0.13 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide?
The IUPAC name of N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide (CID 110126858) is N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide.
What is the SMILES notation for N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide?
The canonical SMILES for N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide is CC(=O)N[C@H]1CCN(Cc2ncc[nH]2)CC[C@@H]1O.
What is the InChIKey of N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide?
The InChIKey is BRWZCLTZGFFPQT-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-9(17)15-10-2-6-16(7-3-11(10)18)8-12-13-4-5-14-12/h4-5,10-11,18H,2-3,6-8H2,1H3,(H,13,14)(H,15,17)/t10-,11-/m0/s1.
What are the key properties of N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide?
N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide has a molecular weight of 252.32 g/mol, XLogP of -0.13, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S,5S)-5-hydroxy-1-(1H-imidazol-2-ylmethyl)azepan-4-yl]acetamide is sourced from PubChem (CID 110126858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).