C17H29N3O4 — CID 110127016
(4aS,9aS)-4-(2-methoxyethyl)-7-(piperidine-4-carbonyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 110127016) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is (4aS,9aS)-4-(2-methoxyethyl)-7-(piperidine-4-carbonyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-4-(2-methoxyethyl)-7-(piperidine-4-carbonyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 110127016 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (4aS,9aS)-4-(2-methoxyethyl)-7-(piperidine-4-carbonyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | COCCN1C(=O)CO[C@H]2CCN(C(=O)C3CCNCC3)CC[C@@H]21 |
| InChI | InChI=1S/C17H29N3O4/c1-23-11-10-20-14-4-8-19(9-5-15(14)24-12-16(20)21)17(22)13-2-6-18-7-3-13/h13-15,18H,2-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | PXYLDNCRMDBTKC-GJZGRUSLSA-N |
| XLogP | -0.15 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |