C17H30O4Si — CID 11012847
1-O-methyl 3-O-trimethylsilyl 2-[(1R)-2-pentylcyclopent-2-en-1-yl]propanedioate (PubChem CID 11012847) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-O-methyl 3-O-trimethylsilyl 2-[(1R)-2-pentylcyclopent-2-en-1-yl]propanedioate.
| Compound Name | 1-O-methyl 3-O-trimethylsilyl 2-[(1R)-2-pentylcyclopent-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 11012847 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-O-methyl 3-O-trimethylsilyl 2-[(1R)-2-pentylcyclopent-2-en-1-yl]propanedioate |
| SMILES | CCCCCC1=CCC[C@@H]1C(C(=O)OC)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-6-7-8-10-13-11-9-12-14(13)15(16(18)20-2)17(19)21-22(3,4)5/h11,14-15H,6-10,12H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | JYFKFQSPLUEUHW-MLCCFXAWSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|