C17H20N2O3S — CID 110128586
1-[(4S,5S)-4-hydroxy-5-pyridin-3-yloxyazepan-1-yl]-2-thiophen-3-ylethanone (PubChem CID 110128586) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[(4S,5S)-4-hydroxy-5-pyridin-3-yloxyazepan-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(4S,5S)-4-hydroxy-5-pyridin-3-yloxyazepan-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 110128586 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[(4S,5S)-4-hydroxy-5-pyridin-3-yloxyazepan-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CC[C@H](Oc2cccnc2)[C@@H](O)CC1 |
| InChI | InChI=1S/C17H20N2O3S/c20-15-3-7-19(17(21)10-13-5-9-23-12-13)8-4-16(15)22-14-2-1-6-18-11-14/h1-2,5-6,9,11-12,15-16,20H,3-4,7-8,10H2/t15-,16-/m0/s1 |
| InChIKey | NGVHODLXLDEYDT-HOTGVXAUSA-N |
| XLogP | 2.12 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |