C21H24F3N3O4S — CID 155854707
1-(4-pyridin-3-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155854707) has the molecular formula C21H24F3N3O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-(4-pyridin-3-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(4-pyridin-3-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854707 |
| Molecular Formula | C21H24F3N3O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-(4-pyridin-3-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1ccsc1)N1CCC2OCCN(c3cccnc3)C2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O2S.C2HF3O2/c23-19(12-15-5-11-25-14-15)21-7-3-17-18(4-8-21)24-10-9-22(17)16-2-1-6-20-13-16;3-2(4,5)1(6)7/h1-2,5-6,11,13-14,17-18H,3-4,7-10,12H2;(H,6,7) |
| InChIKey | HDUREZYRGWXVHH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |