About N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide
N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide (PubChem CID 110130239) has the molecular formula C25H34N2O2
and a molecular weight of 394.56 g/mol. Its IUPAC name is N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide.
Molecular Properties
| Compound Name | N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide |
| PubChem CID | 110130239 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide |
| SMILES | CCN(C(C)=O)[C@@H]1CCO[C@H](c2ccc(CN(C)CCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H34N2O2/c1-4-27(20(2)28)24-15-17-29-25(18-24)23-12-10-22(11-13-23)19-26(3)16-14-21-8-6-5-7-9-21/h5-13,24-25H,4,14-19H2,1-3H3/t24-,25+/m1/s1 |
| InChIKey | ZPIQNQMSWLFSFS-RPBOFIJWSA-N |
| XLogP | 4.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide?
The IUPAC name of N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide (CID 110130239) is N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide.
What is the SMILES notation for N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide?
The canonical SMILES for N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide is CCN(C(C)=O)[C@@H]1CCO[C@H](c2ccc(CN(C)CCc3ccccc3)cc2)C1.
What is the InChIKey of N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide?
The InChIKey is ZPIQNQMSWLFSFS-RPBOFIJWSA-N. The full InChI is InChI=1S/C25H34N2O2/c1-4-27(20(2)28)24-15-17-29-25(18-24)23-12-10-22(11-13-23)19-26(3)16-14-21-8-6-5-7-9-21/h5-13,24-25H,4,14-19H2,1-3H3/t24-,25+/m1/s1.
What are the key properties of N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide?
N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide has a molecular weight of 394.56 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(2S,4R)-2-[4-[[methyl(2-phenylethyl)amino]methyl]phenyl]oxan-4-yl]acetamide is sourced from PubChem (CID 110130239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).