C25H27N3O2 — CID 110130165
N-ethyl-2-phenyl-N-[(2R,4S)-2-(3-pyrimidin-5-ylphenyl)oxan-4-yl]acetamide (PubChem CID 110130165) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-ethyl-2-phenyl-N-[(2R,4S)-2-(3-pyrimidin-5-ylphenyl)oxan-4-yl]acetamide.
| Compound Name | N-ethyl-2-phenyl-N-[(2R,4S)-2-(3-pyrimidin-5-ylphenyl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 110130165 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-ethyl-2-phenyl-N-[(2R,4S)-2-(3-pyrimidin-5-ylphenyl)oxan-4-yl]acetamide |
| SMILES | CCN(C(=O)Cc1ccccc1)[C@H]1CCO[C@@H](c2cccc(-c3cncnc3)c2)C1 |
| InChI | InChI=1S/C25H27N3O2/c1-2-28(25(29)13-19-7-4-3-5-8-19)23-11-12-30-24(15-23)21-10-6-9-20(14-21)22-16-26-18-27-17-22/h3-10,14,16-18,23-24H,2,11-13,15H2,1H3/t23-,24+/m0/s1 |
| InChIKey | TTZYRYRAXKBXIH-BJKOFHAPSA-N |
| XLogP | 4.45 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |