About 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide
4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide (PubChem CID 110130622) has the molecular formula C25H33N3O3
and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide |
| PubChem CID | 110130622 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(N(C)C)cc1)[C@@H]1CCO[C@H](c2ccc(C(=O)N(C)C)cc2)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-6-28(25(30)20-11-13-21(14-12-20)26(2)3)22-15-16-31-23(17-22)18-7-9-19(10-8-18)24(29)27(4)5/h7-14,22-23H,6,15-17H2,1-5H3/t22-,23+/m1/s1 |
| InChIKey | CVNDCBIWFIPHCV-PKTZIBPZSA-N |
| XLogP | 3.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide (CID 110130622) is 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide is CCN(C(=O)c1ccc(N(C)C)cc1)[C@@H]1CCO[C@H](c2ccc(C(=O)N(C)C)cc2)C1.
What is the InChIKey of 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide?
The InChIKey is CVNDCBIWFIPHCV-PKTZIBPZSA-N. The full InChI is InChI=1S/C25H33N3O3/c1-6-28(25(30)20-11-13-21(14-12-20)26(2)3)22-15-16-31-23(17-22)18-7-9-19(10-8-18)24(29)27(4)5/h7-14,22-23H,6,15-17H2,1-5H3/t22-,23+/m1/s1.
What are the key properties of 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide?
4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide has a molecular weight of 423.56 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,4R)-4-[[4-(dimethylamino)benzoyl]-ethylamino]oxan-2-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 110130622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).