C21H24FNO2 — CID 125137566
N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N,3,5-trimethylbenzamide (PubChem CID 125137566) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N,3,5-trimethylbenzamide.
| Compound Name | N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N,3,5-trimethylbenzamide |
|---|---|
| PubChem CID | 125137566 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N,3,5-trimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(C)[C@H]2CCO[C@H](c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C21H24FNO2/c1-14-10-15(2)12-17(11-14)21(24)23(3)19-8-9-25-20(13-19)16-4-6-18(22)7-5-16/h4-7,10-12,19-20H,8-9,13H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | TXNMPJKWMVFOQI-PMACEKPBSA-N |
| XLogP | 4.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |