C20H25FN2O2 — CID 129471608
N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N-methyl-4-pyrrol-1-ylbutanamide (PubChem CID 129471608) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N-methyl-4-pyrrol-1-ylbutanamide.
| Compound Name | N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N-methyl-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 129471608 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(2S,4S)-2-(4-fluorophenyl)oxan-4-yl]-N-methyl-4-pyrrol-1-ylbutanamide |
| SMILES | CN(C(=O)CCCn1cccc1)[C@H]1CCO[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H25FN2O2/c1-22(20(24)5-4-13-23-11-2-3-12-23)18-10-14-25-19(15-18)16-6-8-17(21)9-7-16/h2-3,6-9,11-12,18-19H,4-5,10,13-15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | SSGBAKPPPNRTIU-OALUTQOASA-N |
| XLogP | 3.79 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |