C27H31N3O3 — CID 110130625
N-ethyl-N-[(2S,4R)-2-[4-(propan-2-ylcarbamoyl)phenyl]oxan-4-yl]quinoline-6-carboxamide (PubChem CID 110130625) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-ethyl-N-[(2S,4R)-2-[4-(propan-2-ylcarbamoyl)phenyl]oxan-4-yl]quinoline-6-carboxamide.
| Compound Name | N-ethyl-N-[(2S,4R)-2-[4-(propan-2-ylcarbamoyl)phenyl]oxan-4-yl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 110130625 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-ethyl-N-[(2S,4R)-2-[4-(propan-2-ylcarbamoyl)phenyl]oxan-4-yl]quinoline-6-carboxamide |
| SMILES | CCN(C(=O)c1ccc2ncccc2c1)[C@@H]1CCO[C@H](c2ccc(C(=O)NC(C)C)cc2)C1 |
| InChI | InChI=1S/C27H31N3O3/c1-4-30(27(32)22-11-12-24-21(16-22)6-5-14-28-24)23-13-15-33-25(17-23)19-7-9-20(10-8-19)26(31)29-18(2)3/h5-12,14,16,18,23,25H,4,13,15,17H2,1-3H3,(H,29,31)/t23-,25+/m1/s1 |
| InChIKey | VXXDVZLCNFWEMJ-NOZRDPDXSA-N |
| XLogP | 4.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |