C23H30N4O — CID 110130797
1-[(2S,3aR,8aS)-1-[(2-ethylpyrimidin-5-yl)methyl]-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]ethanone (PubChem CID 110130797) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(2S,3aR,8aS)-1-[(2-ethylpyrimidin-5-yl)methyl]-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]ethanone.
| Compound Name | 1-[(2S,3aR,8aS)-1-[(2-ethylpyrimidin-5-yl)methyl]-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]ethanone |
|---|---|
| PubChem CID | 110130797 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[(2S,3aR,8aS)-1-[(2-ethylpyrimidin-5-yl)methyl]-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]ethanone |
| SMILES | CCc1ncc(CN2[C@H](c3ccccc3)C[C@@H]3[C@@H]2CCCCN3C(C)=O)cn1 |
| InChI | InChI=1S/C23H30N4O/c1-3-23-24-14-18(15-25-23)16-27-20-11-7-8-12-26(17(2)28)22(20)13-21(27)19-9-5-4-6-10-19/h4-6,9-10,14-15,20-22H,3,7-8,11-13,16H2,1-2H3/t20-,21-,22+/m0/s1 |
| InChIKey | GDQCJHBEZBTGSV-FDFHNCONSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |