C15H17N5O2 — CID 110132170
[3-(2-pyrazin-2-ylethyl)morpholin-4-yl]-pyrimidin-2-ylmethanone (PubChem CID 110132170) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [3-(2-pyrazin-2-ylethyl)morpholin-4-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [3-(2-pyrazin-2-ylethyl)morpholin-4-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 110132170 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [3-(2-pyrazin-2-ylethyl)morpholin-4-yl]-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1CCOCC1CCc1cnccn1 |
| InChI | InChI=1S/C15H17N5O2/c21-15(14-18-4-1-5-19-14)20-8-9-22-11-13(20)3-2-12-10-16-6-7-17-12/h1,4-7,10,13H,2-3,8-9,11H2 |
| InChIKey | FSUHEQBXSUNKBK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |