C17H23N5O2 — CID 124998191
4-imidazol-1-yl-1-[(3S)-3-(2-pyrazin-2-ylethyl)morpholin-4-yl]butan-1-one (PubChem CID 124998191) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-imidazol-1-yl-1-[(3S)-3-(2-pyrazin-2-ylethyl)morpholin-4-yl]butan-1-one.
| Compound Name | 4-imidazol-1-yl-1-[(3S)-3-(2-pyrazin-2-ylethyl)morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 124998191 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-imidazol-1-yl-1-[(3S)-3-(2-pyrazin-2-ylethyl)morpholin-4-yl]butan-1-one |
| SMILES | O=C(CCCn1ccnc1)N1CCOC[C@@H]1CCc1cnccn1 |
| InChI | InChI=1S/C17H23N5O2/c23-17(2-1-8-21-9-7-19-14-21)22-10-11-24-13-16(22)4-3-15-12-18-5-6-20-15/h5-7,9,12,14,16H,1-4,8,10-11,13H2/t16-/m0/s1 |
| InChIKey | RFZPLCNVLFMZAG-INIZCTEOSA-N |
| XLogP | 1.31 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |