C13H17N3OS — CID 110132485
3-(4-methyl-1H-pyrazol-5-yl)-4-(thiophen-3-ylmethyl)morpholine (PubChem CID 110132485) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-(4-methyl-1H-pyrazol-5-yl)-4-(thiophen-3-ylmethyl)morpholine.
| Compound Name | 3-(4-methyl-1H-pyrazol-5-yl)-4-(thiophen-3-ylmethyl)morpholine |
|---|---|
| PubChem CID | 110132485 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-(4-methyl-1H-pyrazol-5-yl)-4-(thiophen-3-ylmethyl)morpholine |
| SMILES | Cc1cn[nH]c1C1COCCN1Cc1ccsc1 |
| InChI | InChI=1S/C13H17N3OS/c1-10-6-14-15-13(10)12-8-17-4-3-16(12)7-11-2-5-18-9-11/h2,5-6,9,12H,3-4,7-8H2,1H3,(H,14,15) |
| InChIKey | LXERIJOCYVYTMZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |