C21H27N3O2 — CID 110133579
1-[(4aS,8aR)-4a-methyl-5-(6-methyl-1H-indole-2-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone (PubChem CID 110133579) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-methyl-5-(6-methyl-1H-indole-2-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-methyl-5-(6-methyl-1H-indole-2-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 110133579 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(4aS,8aR)-4a-methyl-5-(6-methyl-1H-indole-2-carbonyl)-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@]2(C)[C@H]1CCCN2C(=O)c1cc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C21H27N3O2/c1-14-7-8-16-13-18(22-17(16)12-14)20(26)24-11-4-6-19-21(24,3)9-5-10-23(19)15(2)25/h7-8,12-13,19,22H,4-6,9-11H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | RCCOTLAUBJKVLA-CTNGQTDRSA-N |
| XLogP | 3.48 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |