C18H24N2O — CID 99811059
[(2S,6R)-2,6-dimethylazepan-1-yl]-(6-methyl-1H-indol-2-yl)methanone (PubChem CID 99811059) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylazepan-1-yl]-(6-methyl-1H-indol-2-yl)methanone.
| Compound Name | [(2S,6R)-2,6-dimethylazepan-1-yl]-(6-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 99811059 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [(2S,6R)-2,6-dimethylazepan-1-yl]-(6-methyl-1H-indol-2-yl)methanone |
| SMILES | Cc1ccc2cc(C(=O)N3C[C@H](C)CCC[C@@H]3C)[nH]c2c1 |
| InChI | InChI=1S/C18H24N2O/c1-12-7-8-15-10-17(19-16(15)9-12)18(21)20-11-13(2)5-4-6-14(20)3/h7-10,13-14,19H,4-6,11H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | WYYZQHFNYRQOGX-KGLIPLIRSA-N |
| XLogP | 4.13 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |