C16H32N4O4 — CID 11013360
tert-butyl N-[N'-(5-aminopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 11013360) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl N-[N'-(5-aminopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-(5-aminopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 11013360 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | tert-butyl N-[N'-(5-aminopentyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32N4O4/c1-15(2,3)23-13(21)19-12(18-11-9-7-8-10-17)20-14(22)24-16(4,5)6/h7-11,17H2,1-6H3,(H2,18,19,20,21,22) |
| InChIKey | BUYKGDWHJJZUHK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|