C22H30FNO4 — CID 110134454
N-[(5S,6S,8R,10S)-5-(2-fluoro-4-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide (PubChem CID 110134454) has the molecular formula C22H30FNO4 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[(5S,6S,8R,10S)-5-(2-fluoro-4-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide.
| Compound Name | N-[(5S,6S,8R,10S)-5-(2-fluoro-4-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 110134454 |
| Molecular Formula | C22H30FNO4 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N-[(5S,6S,8R,10S)-5-(2-fluoro-4-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide |
| SMILES | COc1ccc([C@H]2OCCC34C[C@@H](C[C@H]23)C(C)(C)[C@@H]4NC(=O)CCO)c(F)c1 |
| InChI | InChI=1S/C22H30FNO4/c1-21(2)13-10-16-19(15-5-4-14(27-3)11-17(15)23)28-9-7-22(16,12-13)20(21)24-18(26)6-8-25/h4-5,11,13,16,19-20,25H,6-10,12H2,1-3H3,(H,24,26)/t13-,16-,19-,20+,22?/m1/s1 |
| InChIKey | VNCGKEBNKLJASY-GGTVBVTGSA-N |
| XLogP | 3.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |