C21H27F2NO3 — CID 110134977
N-[(5S,6S,8R,10R)-5-(2,4-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide (PubChem CID 110134977) has the molecular formula C21H27F2NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[(5S,6S,8R,10R)-5-(2,4-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide.
| Compound Name | N-[(5S,6S,8R,10R)-5-(2,4-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 110134977 |
| Molecular Formula | C21H27F2NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(5S,6S,8R,10R)-5-(2,4-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]-3-hydroxypropanamide |
| SMILES | CC1(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(F)cc4F)OCCC3(C2)[C@@H]1NC(=O)CCO |
| InChI | InChI=1S/C21H27F2NO3/c1-20(2)12-9-15-18(14-4-3-13(22)10-16(14)23)27-8-6-21(15,11-12)19(20)24-17(26)5-7-25/h3-4,10,12,15,18-19,25H,5-9,11H2,1-2H3,(H,24,26)/t12-,15-,18-,19-,21?/m1/s1 |
| InChIKey | AIDGZRJTOCRGLD-FTBFBDOPSA-N |
| XLogP | 3.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |