C20H25F2NO2 — CID 124985288
N-[(1S,5S,6S,8R,10S)-5-(2,5-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 124985288) has the molecular formula C20H25F2NO2 and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[(1S,5S,6S,8R,10S)-5-(2,5-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(1S,5S,6S,8R,10S)-5-(2,5-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 124985288 |
| Molecular Formula | C20H25F2NO2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[(1S,5S,6S,8R,10S)-5-(2,5-difluorophenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4cc(F)ccc4F)OCC[C@@]31C2 |
| InChI | InChI=1S/C20H25F2NO2/c1-11(24)23-18-19(2,3)12-8-15-17(25-7-6-20(15,18)10-12)14-9-13(21)4-5-16(14)22/h4-5,9,12,15,17-18H,6-8,10H2,1-3H3,(H,23,24)/t12-,15-,17-,18+,20-/m1/s1 |
| InChIKey | NQSBIDKOQYCVJV-VLRUMRAESA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |