C26H36N4O — CID 110137227
(3aR,9aR)-1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3a-methyl-4-[(2-methylphenyl)methyl]-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocin-5-one (PubChem CID 110137227) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is (3aR,9aR)-1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3a-methyl-4-[(2-methylphenyl)methyl]-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocin-5-one.
| Compound Name | (3aR,9aR)-1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3a-methyl-4-[(2-methylphenyl)methyl]-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110137227 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (3aR,9aR)-1-[[2-(dimethylamino)-3-pyridinyl]methyl]-3a-methyl-4-[(2-methylphenyl)methyl]-3,6,7,8,9,9a-hexahydro-2H-pyrrolo[3,2-b]azocin-5-one |
| SMILES | Cc1ccccc1CN1C(=O)CCCC[C@H]2N(Cc3cccnc3N(C)C)CC[C@]21C |
| InChI | InChI=1S/C26H36N4O/c1-20-10-5-6-11-21(20)19-30-24(31)14-8-7-13-23-26(30,2)15-17-29(23)18-22-12-9-16-27-25(22)28(3)4/h5-6,9-12,16,23H,7-8,13-15,17-19H2,1-4H3/t23-,26-/m1/s1 |
| InChIKey | JBUZRNRTVNVIIM-ZEQKJWHPSA-N |
| XLogP | 4.39 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |